CAS 699016-44-9 appears in our catalog under these names: 5-Chlorosulfonyl-2-hydroxy-4-methyl-benzoic acid methyl ester, 95%, Methyl 5-(chlorosulfonyl)-2-hydroxy-4-methylbenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 5-chlorosulfonyl-2-hydroxy-4-methylbenzoate (CAS 699016-44-9) is a chemical compound with the molecular formula C9H9ClO5S and a molecular weight of 264.68 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2-hydroxy-4-methylbenzoate. InChIKey: GNEJTBDFHDQPOE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO5S |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2-hydroxy-4-methylbenzoate |
| InChIKey | GNEJTBDFHDQPOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)OC)O |
Computed by PubChem (NCBI)