CAS 85591-40-8 is the registry number for 5-(Chlorosulfonyl)-2-methoxy-4-methylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chlorosulfonyl-2-methoxy-4-methylbenzoic acid (CAS 85591-40-8) is a chemical compound with the molecular formula C9H9ClO5S and a molecular weight of 264.68 g/mol. IUPAC name: 5-chlorosulfonyl-2-methoxy-4-methylbenzoic acid. InChIKey: QWVXRQUIXZNBBE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO5S |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-methoxy-4-methylbenzoic acid |
| InChIKey | QWVXRQUIXZNBBE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)O)OC |
Computed by PubChem (NCBI)