CAS 191471-91-7 appears in our catalog under these names: Sulpiride Impurity 16, Methyl 5-(chlorosulfonyl)-2-methoxybenzoate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
Methyl 5-chlorosulfonyl-2-methoxybenzoate (CAS 191471-91-7) is a chemical compound with the molecular formula C9H9ClO5S and a molecular weight of 264.68 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2-methoxybenzoate. InChIKey: YDEWENZFUMWNIM-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO5S |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2-methoxybenzoate |
| InChIKey | YDEWENZFUMWNIM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)OC |
Computed by PubChem (NCBI)