CAS 1049677-52-2 is the registry number for 1-Boc-3,3-dimethyl-6-nitroindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate (CAS 1049677-52-2) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate. InChIKey: LXCSKRDBTOIEGW-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-6-nitro-2H-indole-1-carboxylate |
| InChIKey | LXCSKRDBTOIEGW-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=CC(=C2)[N+](=O)[O-])C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)