CAS 1049712-73-3 is the registry number for {(5-(4-bromophenyl)furan-2-yl)methyl}(methyl)amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[5-(4-bromophenyl)furan-2-yl]-N-methylmethanamine;hydrochloride (CAS 1049712-73-3) is a chemical compound with the molecular formula C12H13BrClNO and a molecular weight of 302.59 g/mol. IUPAC name: 1-[5-(4-bromophenyl)furan-2-yl]-N-methylmethanamine;hydrochloride. InChIKey: ZUDLCWIKKFHNJA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrClNO |
|---|---|
| Molecular weight | 302.59 g/mol |
| IUPAC name | 1-[5-(4-bromophenyl)furan-2-yl]-N-methylmethanamine;hydrochloride |
| InChIKey | ZUDLCWIKKFHNJA-UHFFFAOYSA-N |
| SMILES | CNCC1=CC=C(O1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)