CAS 2059938-77-9 is the registry number for 5-Bromo-6-chloro-1,2-dihydrospiro(indole-3,4'-oxane), 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-6-chlorospiro[1,2-dihydroindole-3,4'-oxane] (CAS 2059938-77-9) is a chemical compound with the molecular formula C12H13BrClNO and a molecular weight of 302.59 g/mol. IUPAC name: 5-bromo-6-chlorospiro[1,2-dihydroindole-3,4'-oxane]. InChIKey: DRAFASIQPWYXPB-UHFFFAOYSA-N.
| Molecular formula | C12H13BrClNO |
|---|---|
| Molecular weight | 302.59 g/mol |
| IUPAC name | 5-bromo-6-chlorospiro[1,2-dihydroindole-3,4'-oxane] |
| InChIKey | DRAFASIQPWYXPB-UHFFFAOYSA-N |
| SMILES | C1COCCC12CNC3=CC(=C(C=C23)Br)Cl |
Computed by PubChem (NCBI)