CAS 1049718-57-1 appears in our catalog under these names: 3-Deschloro-2-Chloro Bupropion HCl, Bupropion Impurity 9(2-Chloro Analog), 3-Deschloro-2-chloro Bupropion Hydrochloride, >95% (HPLC), 2-(tert-Butylamino)-2'-chloropropiophenone hydrochloride, 3-Deschloro-2-chloro Bupropion Hydrochloride, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 20mg.
2-(tert-butylamino)-1-(2-chlorophenyl)propan-1-one;hydrochloride (CAS 1049718-57-1) is a chemical compound with the molecular formula C13H19Cl2NO and a molecular weight of 276.20 g/mol. IUPAC name: 2-(tert-butylamino)-1-(2-chlorophenyl)propan-1-one;hydrochloride. InChIKey: PYZQPDKRPYOMAL-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2NO |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(2-chlorophenyl)propan-1-one;hydrochloride |
| InChIKey | PYZQPDKRPYOMAL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1Cl)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)