CAS 30060-91-4 is the registry number for Lometraline (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-5-methoxy-N,N-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 30060-91-4) is a chemical compound with the molecular formula C13H19Cl2NO and a molecular weight of 276.20 g/mol. IUPAC name: 8-chloro-5-methoxy-N,N-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: XYTNPORBXPAQMP-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2NO |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | 8-chloro-5-methoxy-N,N-dimethyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | XYTNPORBXPAQMP-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCCC2=C(C=CC(=C12)Cl)OC.Cl |
Computed by PubChem (NCBI)