CAS 1189725-26-5 appears in our catalog under these names: Bupropion-d9 HCl, Bupropion-d9 Hydrochloride, >95% (HPLC), (±)-Bupropion-d9 HCl (tert-butyl-d9), 99 atom % D, min 98% Chemical Purity, Bupropion–d9 (hydrochloride). Offered by: Chemat Brand, TRC, CDN, GLPBio. Available pack sizes: on request, 10mg, 1mg, 5mg, 0,01g, 0,005g.
1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride (CAS 1189725-26-5) is a chemical compound with the molecular formula C13H19Cl2NO and a molecular weight of 285.25 g/mol. IUPAC name: 1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride. InChIKey: HEYVINCGKDONRU-WWMMTMLWSA-N.
| Molecular formula | C13H19Cl2NO |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]propan-1-one;hydrochloride |
| InChIKey | HEYVINCGKDONRU-WWMMTMLWSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NC(C)C(=O)C1=CC(=CC=C1)Cl.Cl |
Computed by PubChem (NCBI)