Products 391954-26-0

CAS 391954-26-0 is the registry number for 4-(2-Chloro-5-methoxybenzyl)piperidine hydrochloride 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(2-chloro-5-methoxyphenyl)methyl]piperidine;hydrochloride (CAS 391954-26-0) is a chemical compound with the molecular formula C13H19Cl2NO and a molecular weight of 276.20 g/mol. IUPAC name: 4-[(2-chloro-5-methoxyphenyl)methyl]piperidine;hydrochloride. InChIKey: FIJNSIIETVJGRE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19Cl2NO
Molecular weight276.20 g/mol
IUPAC name4-[(2-chloro-5-methoxyphenyl)methyl]piperidine;hydrochloride
InChIKeyFIJNSIIETVJGRE-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Cl)CC2CCNCC2.Cl

Computed by PubChem (NCBI)