CAS 1049736-67-5 is the registry number for 2-(6,7-Dichloro-2-methyl-1h-indol-3-yl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049736-67-5) is a chemical compound with the molecular formula C11H13Cl3N2 and a molecular weight of 279.6 g/mol. IUPAC name: 2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: HUYCTEWGLRHGFK-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2 |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 2-(6,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | HUYCTEWGLRHGFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=C(C=C2)Cl)Cl)CCN.Cl |
Computed by PubChem (NCBI)