CAS 1049742-84-8 appears in our catalog under these names: 2-(4,6-Dichloro-2-methyl-1h-indol-3-yl)ethanamine hydrochloride, 95%, DCAI Hydrochloride. Offered by: Combi-blocks, TargetMol. Available pack sizes: 250mg, 100mg, 25mg, 50mg.
2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049742-84-8) is a chemical compound with the molecular formula C11H13Cl3N2 and a molecular weight of 279.6 g/mol. IUPAC name: 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: ZHOLRBWPQNSIHI-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2 |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | ZHOLRBWPQNSIHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=C(C=C2Cl)Cl)CCN.Cl |
Computed by PubChem (NCBI)