CAS 2253621-22-4 is the registry number for 3-Chloro-2-(4,4-dichloro-1-piperidinyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-2-(4,4-dichloropiperidin-1-yl)aniline (CAS 2253621-22-4) is a chemical compound with the molecular formula C11H13Cl3N2 and a molecular weight of 279.6 g/mol. IUPAC name: 3-chloro-2-(4,4-dichloropiperidin-1-yl)aniline. InChIKey: NJHCPNBAUCMEPA-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2 |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 3-chloro-2-(4,4-dichloropiperidin-1-yl)aniline |
| InChIKey | NJHCPNBAUCMEPA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(Cl)Cl)C2=C(C=CC=C2Cl)N |
Computed by PubChem (NCBI)