CAS 1049759-52-5 appears in our catalog under these names: 2-(5,7-Dichloro-2-methyl-1H-indol-3-yl)ethanamine Hydrochloride, 2-(5,7-Dichloro-2-methyl-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1g, 5g, 2g.
2-(5,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1049759-52-5) is a chemical compound with the molecular formula C11H13Cl3N2 and a molecular weight of 279.6 g/mol. IUPAC name: 2-(5,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: JBOPFZBTUCWNMV-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl3N2 |
|---|---|
| Molecular weight | 279.6 g/mol |
| IUPAC name | 2-(5,7-dichloro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | JBOPFZBTUCWNMV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C(=CC(=C2)Cl)Cl)CCN.Cl |
Computed by PubChem (NCBI)