CAS 1049743-55-6 is the registry number for (2S,4R)-4-(3-(Trifluoromethyl)benzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2S,4R)-4-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049743-55-6) is a chemical compound with the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. IUPAC name: (2S,4R)-4-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: POALZTWRXIMVHI-XQKZEKTMSA-N.
| Molecular formula | C13H15ClF3NO2 |
|---|---|
| Molecular weight | 309.71 g/mol |
| IUPAC name | (2S,4R)-4-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | POALZTWRXIMVHI-XQKZEKTMSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)