Products 1647124-77-3
CAS 1647124-77-3 is the registry number for tert-Butyl (2-(chloromethyl)-5-(trifluoromethyl)phenyl)carbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
Tert-butyl N-[2-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate (CAS 1647124-77-3) is a chemical compound with the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. IUPAC name: tert-butyl N-[2-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate. InChIKey: WVFFWJMYJRQCHA-UHFFFAOYSA-N.
| Molecular formula | C13H15ClF3NO2 |
|---|---|
| Molecular weight | 309.71 g/mol |
| IUPAC name | tert-butyl N-[2-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | WVFFWJMYJRQCHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)