Products 2279122-92-6
CAS 2279122-92-6 is the registry number for 2-Piperidin-1-yl-3-trifluoromethyl-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
2-piperidin-1-yl-3-(trifluoromethyl)benzoic acid;hydrochloride (CAS 2279122-92-6) is a chemical compound with the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. IUPAC name: 2-piperidin-1-yl-3-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: UEHVOANFRHNXRB-UHFFFAOYSA-N.
| Molecular formula | C13H15ClF3NO2 |
|---|---|
| Molecular weight | 309.71 g/mol |
| IUPAC name | 2-piperidin-1-yl-3-(trifluoromethyl)benzoic acid;hydrochloride |
| InChIKey | UEHVOANFRHNXRB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=CC=C2C(F)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)