CAS 1235440-72-8 is the registry number for tert-Butyl N-(3-(chloromethyl)-5-(trifluoromethyl)phenyl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Tert-butyl N-[3-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate (CAS 1235440-72-8) is a chemical compound with the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. IUPAC name: tert-butyl N-[3-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate. InChIKey: YXCWIXZTHGEEJV-UHFFFAOYSA-N.
| Molecular formula | C13H15ClF3NO2 |
|---|---|
| Molecular weight | 309.71 g/mol |
| IUPAC name | tert-butyl N-[3-(chloromethyl)-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | YXCWIXZTHGEEJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)