CAS 1049745-41-6 is the registry number for (2S,4S)-4-(Thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049745-41-6) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: (2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: BFWVVLPPUAXRAI-HNJRQZNRSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | (2S,4S)-4-(1,3-thiazol-4-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | BFWVVLPPUAXRAI-HNJRQZNRSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CSC=N2.Cl |
Computed by PubChem (NCBI)