CAS 892952-70-4 is the registry number for tert-Butyl 4-(chloromethyl)thiazol-2-ylcarbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate (CAS 892952-70-4) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: tert-butyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate. InChIKey: NYMXQKNNEPFDPR-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | tert-butyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate |
| InChIKey | NYMXQKNNEPFDPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)CCl |
Computed by PubChem (NCBI)