Products 1708958-62-6
CAS 1708958-62-6 is the registry number for (5-Chloro-2-((isopropylsulfonyl)phenyl)-hydrazine. Offered by: TRC. Available pack sizes: 500mg.
(5-chloro-2-propan-2-ylsulfonylphenyl)hydrazine (CAS 1708958-62-6) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: (5-chloro-2-propan-2-ylsulfonylphenyl)hydrazine. InChIKey: FEXFXVRPNXBFRQ-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | (5-chloro-2-propan-2-ylsulfonylphenyl)hydrazine |
| InChIKey | FEXFXVRPNXBFRQ-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=C(C=C(C=C1)Cl)NN |
Computed by PubChem (NCBI)