CAS 1354704-84-9 is the registry number for 1-Cyclopentyl-5-methyl-1H-pyrazole-3-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclopentyl-5-methylpyrazole-3-sulfonyl chloride (CAS 1354704-84-9) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: 1-cyclopentyl-5-methylpyrazole-3-sulfonyl chloride. InChIKey: IPZQJARTBUROMN-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 1-cyclopentyl-5-methylpyrazole-3-sulfonyl chloride |
| InChIKey | IPZQJARTBUROMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2CCCC2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)