CAS 1049752-62-6 is the registry number for {4-(2-(2-Pyridinyl)ethoxy)phenyl}amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
4-(2-pyridin-2-ylethoxy)aniline;dihydrochloride (CAS 1049752-62-6) is a chemical compound with the molecular formula C13H16Cl2N2O and a molecular weight of 287.18 g/mol. IUPAC name: 4-(2-pyridin-2-ylethoxy)aniline;dihydrochloride. InChIKey: KJSFPJSINSTQEQ-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 4-(2-pyridin-2-ylethoxy)aniline;dihydrochloride |
| InChIKey | KJSFPJSINSTQEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CCOC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)