CAS 2222118-99-0 is the registry number for Rel-4-(((1s,4s)-4-aminocyclohexyl)oxy)-2-chlorobenzonitrile hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-aminocyclohexyl)oxy-2-chlorobenzonitrile;hydrochloride (CAS 2222118-99-0) is a chemical compound with the molecular formula C13H16Cl2N2O and a molecular weight of 287.18 g/mol. IUPAC name: 4-(4-aminocyclohexyl)oxy-2-chlorobenzonitrile;hydrochloride. InChIKey: OTDXWZDXJFKORN-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 4-(4-aminocyclohexyl)oxy-2-chlorobenzonitrile;hydrochloride |
| InChIKey | OTDXWZDXJFKORN-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)OC2=CC(=C(C=C2)C#N)Cl.Cl |
Computed by PubChem (NCBI)