Products 1251924-98-7
CAS 1251924-98-7 is the registry number for 6-Chloro-3-(piperidin-4-yl)-2,3-dihydro-1H-indol-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-3-piperidin-4-yl-1,3-dihydroindol-2-one;hydrochloride (CAS 1251924-98-7) is a chemical compound with the molecular formula C13H16Cl2N2O and a molecular weight of 287.18 g/mol. IUPAC name: 6-chloro-3-piperidin-4-yl-1,3-dihydroindol-2-one;hydrochloride. InChIKey: QHOCGPCYQJPUET-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 6-chloro-3-piperidin-4-yl-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | QHOCGPCYQJPUET-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2C3=C(C=C(C=C3)Cl)NC2=O.Cl |
Computed by PubChem (NCBI)