CAS 1049791-13-0 appears in our catalog under these names: (3-[2-(2-Pyridinyl)ethoxy]phenyl)amine dihydrochloride, 95%, 3-(2-(Pyridin-2-yl)ethoxy)aniline dihydrochloride, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 500mg, on request.
3-(2-pyridin-2-ylethoxy)aniline;dihydrochloride (CAS 1049791-13-0) is a chemical compound with the molecular formula C13H16Cl2N2O and a molecular weight of 287.18 g/mol. IUPAC name: 3-(2-pyridin-2-ylethoxy)aniline;dihydrochloride. InChIKey: JBLXLFGURVREGO-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 3-(2-pyridin-2-ylethoxy)aniline;dihydrochloride |
| InChIKey | JBLXLFGURVREGO-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CCOC2=CC=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)