CAS 1808330-40-6 is the registry number for (3R,4S)-4-Phenylpyrrolidine-3-carboxylic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R,4S)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1808330-40-6) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (3R,4S)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: UDMOMQDXMDMSAV-UXQCFNEQSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (3R,4S)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | UDMOMQDXMDMSAV-UXQCFNEQSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)