CAS 1049756-81-1 appears in our catalog under these names: 1-(4-(Piperazine-1-sulfonyl)phenyl)ethan-1-one hydrochloride, 1-(4-(Piperazine-1-sulfonyl)phenyl)ethan-1-one hydrochloride, 95%, 1-[4-(Piperazin-1-ylsulfonyl)phenyl]ethanone hydrochloride, 95%, 1-(4-(1-Piperazinylsulfonyl)phenyl)ethanone Hydrochloride, >95% (HPLC). Offered by: Biosynth, AmBeed, Combi-blocks, TRC. Available pack sizes: 0,5g, 5g, 10g, 250mg, 1g, 100mg, 500mg.
1-(4-piperazin-1-ylsulfonylphenyl)ethanone;hydrochloride (CAS 1049756-81-1) is a chemical compound with the molecular formula C12H17ClN2O3S and a molecular weight of 304.79 g/mol. IUPAC name: 1-(4-piperazin-1-ylsulfonylphenyl)ethanone;hydrochloride. InChIKey: IZUJYVDNJPGALP-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3S |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 1-(4-piperazin-1-ylsulfonylphenyl)ethanone;hydrochloride |
| InChIKey | IZUJYVDNJPGALP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)