Products 743444-34-0
CAS 743444-34-0 appears in our catalog under these names: 2-Chloro-N-(5-(dimethylsulfamoyl)-2-methylphenyl)propanamide, 95%, 2-Chloro-N-(5-(dimethylsulfamoyl)-2-methylphenyl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide (CAS 743444-34-0) is a chemical compound with the molecular formula C12H17ClN2O3S and a molecular weight of 304.79 g/mol. IUPAC name: 2-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide. InChIKey: YUYQDWSUJMXBHY-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3S |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 2-chloro-N-[5-(dimethylsulfamoyl)-2-methylphenyl]propanamide |
| InChIKey | YUYQDWSUJMXBHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N(C)C)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)