CAS 678185-73-4 appears in our catalog under these names: 4-(3-Butylureido)-2-methylbenzenesulfonylchloride, 98%, 4-(3-Butylureido)-2-methylbenzene-1-sulfonyl chloride, 95+%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g, 5g.
4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride (CAS 678185-73-4) is a chemical compound with the molecular formula C12H17ClN2O3S and a molecular weight of 304.79 g/mol. IUPAC name: 4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride. InChIKey: SQAXKSRGKWAYEX-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3S |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 4-(butylcarbamoylamino)-2-methylbenzenesulfonyl chloride |
| InChIKey | SQAXKSRGKWAYEX-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NC1=CC(=C(C=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)