CAS 1311315-43-1 appears in our catalog under these names: 1-(3-Methanesulfonylbenzoyl)piperazine hydrochloride, 1-(3-Methanesulfonylbenzoyl)piperazine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
(3-methylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 1311315-43-1) is a chemical compound with the molecular formula C12H17ClN2O3S and a molecular weight of 304.79 g/mol. IUPAC name: (3-methylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: KBRWEHHWELTNMZ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O3S |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | (3-methylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | KBRWEHHWELTNMZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)