CAS 1049801-48-0 is the registry number for 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)piperazine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine (CAS 1049801-48-0) is a chemical compound with the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine. InChIKey: BJVMUAXOFMSMHX-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O2S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine |
| InChIKey | BJVMUAXOFMSMHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCNCC2 |
Computed by PubChem (NCBI)