CAS 627837-60-9 is the registry number for N,N-Diethyl-6-hydrazinylpyridine-3-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N,N-diethyl-6-hydrazinylpyridine-3-sulfonamide (CAS 627837-60-9) is a chemical compound with the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. IUPAC name: N,N-diethyl-6-hydrazinylpyridine-3-sulfonamide. InChIKey: ONANFVOQDHHSGY-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O2S |
|---|---|
| Molecular weight | 244.32 g/mol |
| IUPAC name | N,N-diethyl-6-hydrazinylpyridine-3-sulfonamide |
| InChIKey | ONANFVOQDHHSGY-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CN=C(C=C1)NN |
Computed by PubChem (NCBI)