CAS 1049801-63-9 appears in our catalog under these names: 1-(3-bromophenyl)pyrimidine-2,4-dione, 95%, CRBN ligand-889. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
1-(3-bromophenyl)pyrimidine-2,4-dione (CAS 1049801-63-9) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 1-(3-bromophenyl)pyrimidine-2,4-dione. InChIKey: LRFYPUMLEWYOGB-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-(3-bromophenyl)pyrimidine-2,4-dione |
| InChIKey | LRFYPUMLEWYOGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=CC(=O)NC2=O |
Computed by PubChem (NCBI)