CAS 1049872-71-0 is the registry number for 1-(2-(Trifluoromethyl)phenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid (CAS 1049872-71-0) is a chemical compound with the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid. InChIKey: UBEKXLWMTSODOC-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N3O2 |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)phenyl]triazole-4-carboxylic acid |
| InChIKey | UBEKXLWMTSODOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)