CAS 215500-55-3 appears in our catalog under these names: 1-(4-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole, 95+%, 1-(4-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole (CAS 215500-55-3) is a chemical compound with the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. IUPAC name: 1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole. InChIKey: WQWWBEDKNRJDTQ-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N3O2 |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole |
| InChIKey | WQWWBEDKNRJDTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=CC=N2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)