Products 25373-61-9
CAS 25373-61-9 is the registry number for 1-[2-Nitro-4-(trifluoromethyl)phenyl]-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole (CAS 25373-61-9) is a chemical compound with the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. IUPAC name: 1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole. InChIKey: JSZWGVPOLFJCQQ-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N3O2 |
|---|---|
| Molecular weight | 257.17 g/mol |
| IUPAC name | 1-[2-nitro-4-(trifluoromethyl)phenyl]imidazole |
| InChIKey | JSZWGVPOLFJCQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])N2C=CN=C2 |
Computed by PubChem (NCBI)