Products 2137681-57-1

CAS 2137681-57-1 is the registry number for 1-(Pyridin-2-yl)-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 2137681-57-1) is a chemical compound with the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. IUPAC name: 1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: NANAWAASHDFWSU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F3N3O2
Molecular weight257.17 g/mol
IUPAC name1-pyridin-2-yl-5-(trifluoromethyl)pyrazole-3-carboxylic acid
InChIKeyNANAWAASHDFWSU-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)N2C(=CC(=N2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)