CAS 1049981-92-1 is the registry number for (2S,4R)-4-(3-Iodobenzyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S,4R)-4-[(3-iodophenyl)methyl]pyrrolidine-2-carboxylic acid (CAS 1049981-92-1) is a chemical compound with the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. IUPAC name: (2S,4R)-4-[(3-iodophenyl)methyl]pyrrolidine-2-carboxylic acid. InChIKey: LWYGQQGSMMEYSJ-KOLCDFICSA-N.
| Molecular formula | C12H14INO2 |
|---|---|
| Molecular weight | 331.15 g/mol |
| IUPAC name | (2S,4R)-4-[(3-iodophenyl)methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | LWYGQQGSMMEYSJ-KOLCDFICSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC(=CC=C2)I |
Computed by PubChem (NCBI)