CAS 1353995-39-7 appears in our catalog under these names: (R)-3-Iodo-pyrrolidine-1-carboxylic acid benzyl ester, 95%, (R)-Benzyl 3-iodopyrrolidine-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Benzyl (3R)-3-iodopyrrolidine-1-carboxylate (CAS 1353995-39-7) is a chemical compound with the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. IUPAC name: benzyl (3R)-3-iodopyrrolidine-1-carboxylate. InChIKey: PHSGVWBPCLSEFX-LLVKDONJSA-N.
| Molecular formula | C12H14INO2 |
|---|---|
| Molecular weight | 331.15 g/mol |
| IUPAC name | benzyl (3R)-3-iodopyrrolidine-1-carboxylate |
| InChIKey | PHSGVWBPCLSEFX-LLVKDONJSA-N |
| SMILES | C1CN(C[C@@H]1I)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)