CAS 1234615-79-2 appears in our catalog under these names: 3-Iodo-pyrrolidine-1-carboxylic acid benzyl ester, 95%, Benzyl 3-Iodopyrrolidine-1-carboxylate, 97%, 3-Iodo-pyrrolidine-1-carboxylic acid benzyl ester, 96%, 96%, 3-Iodo-pyrrolidine-1-carboxylic acid benzyl ester, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 500mg.
Benzyl 3-iodopyrrolidine-1-carboxylate (CAS 1234615-79-2) is a chemical compound with the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. IUPAC name: benzyl 3-iodopyrrolidine-1-carboxylate. InChIKey: PHSGVWBPCLSEFX-UHFFFAOYSA-N.
| Molecular formula | C12H14INO2 |
|---|---|
| Molecular weight | 331.15 g/mol |
| IUPAC name | benzyl 3-iodopyrrolidine-1-carboxylate |
| InChIKey | PHSGVWBPCLSEFX-UHFFFAOYSA-N |
| SMILES | C1CN(CC1I)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)