CAS 913484-66-9 is the registry number for (3-Hydroxy-4-iodo-phenyl)-piperidin-1-yl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-hydroxy-4-iodophenyl)-piperidin-1-ylmethanone (CAS 913484-66-9) is a chemical compound with the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. IUPAC name: (3-hydroxy-4-iodophenyl)-piperidin-1-ylmethanone. InChIKey: OQLCSVFETTUQJW-UHFFFAOYSA-N.
| Molecular formula | C12H14INO2 |
|---|---|
| Molecular weight | 331.15 g/mol |
| IUPAC name | (3-hydroxy-4-iodophenyl)-piperidin-1-ylmethanone |
| InChIKey | OQLCSVFETTUQJW-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=C(C=C2)I)O |
Computed by PubChem (NCBI)