CAS 1050513-84-2 is the registry number for 3-Amino-5-methoxy-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-amino-5-methoxy-N,N-dimethylbenzamide (CAS 1050513-84-2) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 3-amino-5-methoxy-N,N-dimethylbenzamide. InChIKey: PVHMLENOZFAWHZ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-amino-5-methoxy-N,N-dimethylbenzamide |
| InChIKey | PVHMLENOZFAWHZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)OC)N |
Computed by PubChem (NCBI)