Products 1050885-72-7
CAS 1050885-72-7 appears in our catalog under these names: 3-Methyl-8-(piperazine-1-sulfonyl)quinoline, 95%, 3-Methyl-8-(piperazine-1-sulfonyl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-methyl-8-piperazin-1-ylsulfonylquinoline (CAS 1050885-72-7) is a chemical compound with the molecular formula C14H17N3O2S and a molecular weight of 291.37 g/mol. IUPAC name: 3-methyl-8-piperazin-1-ylsulfonylquinoline. InChIKey: GTHOTHBDECTHNG-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | 3-methyl-8-piperazin-1-ylsulfonylquinoline |
| InChIKey | GTHOTHBDECTHNG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)S(=O)(=O)N3CCNCC3)N=C1 |
Computed by PubChem (NCBI)