CAS 1050910-17-2 is the registry number for 5-(4-(2-Chloroacetyl)piperazin-1-yl)-2-methyl-1,3-oxazole-4-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-[4-(2-chloroacetyl)piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile (CAS 1050910-17-2) is a chemical compound with the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. IUPAC name: 5-[4-(2-chloroacetyl)piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile. InChIKey: KMZAIUJDKHUTKW-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O2 |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 5-[4-(2-chloroacetyl)piperazin-1-yl]-2-methyl-1,3-oxazole-4-carbonitrile |
| InChIKey | KMZAIUJDKHUTKW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)N2CCN(CC2)C(=O)CCl)C#N |
Computed by PubChem (NCBI)