CAS 2279124-10-4 is the registry number for 3-[5-(Aminomethyl)-1,2,4-oxadiazol-3-yl]-n-methylbenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide;hydrochloride (CAS 2279124-10-4) is a chemical compound with the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. IUPAC name: 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide;hydrochloride. InChIKey: BAOVZEBBDZYEHS-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O2 |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-N-methylbenzamide;hydrochloride |
| InChIKey | BAOVZEBBDZYEHS-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC(=C1)C2=NOC(=N2)CN.Cl |
Computed by PubChem (NCBI)