CAS 1443979-40-5 appears in our catalog under these names: 2-Amino-3-(1-phenyl-1H-1,2,3-triazol-4-yl)propanoic acid hydrochloride, 95%, 2-Amino-3-(1-phenyl-1H-1,2,3-triazol-4-yl)propanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-3-(1-phenyltriazol-4-yl)propanoic acid;hydrochloride (CAS 1443979-40-5) is a chemical compound with the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. IUPAC name: 2-amino-3-(1-phenyltriazol-4-yl)propanoic acid;hydrochloride. InChIKey: NPEUQANRJDUWNP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O2 |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 2-amino-3-(1-phenyltriazol-4-yl)propanoic acid;hydrochloride |
| InChIKey | NPEUQANRJDUWNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)