CAS 1352516-45-0 is the registry number for 2-Amino-n-((3-phenyl-1,2,4-oxadiazol-5-yl)methyl)acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]acetamide;hydrochloride (CAS 1352516-45-0) is a chemical compound with the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. IUPAC name: 2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]acetamide;hydrochloride. InChIKey: SOFWAOUIOZDNNX-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN4O2 |
|---|---|
| Molecular weight | 268.70 g/mol |
| IUPAC name | 2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]acetamide;hydrochloride |
| InChIKey | SOFWAOUIOZDNNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CNC(=O)CN.Cl |
Computed by PubChem (NCBI)