CAS 105105-00-8 appears in our catalog under these names: 4-(2,3-Dihydro-1h-indol-1-yl)-4-oxobutanoic acid, 95%, 4-(2,3-Dihydro-1H-indol-1-yl)-4-oxobutanoic Acid, 4-(2,3-Dihydro-indol-1-yl)-4-oxo-butyric acid, 4-(Indolin-1-yl)-4-oxobutanoic acid, 95+%. Offered by: Combi-blocks, TRC, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
4-(2,3-dihydroindol-1-yl)-4-oxobutanoic acid (CAS 105105-00-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(2,3-dihydroindol-1-yl)-4-oxobutanoic acid. InChIKey: SWNRXQYQTQVWKA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-(2,3-dihydroindol-1-yl)-4-oxobutanoic acid |
| InChIKey | SWNRXQYQTQVWKA-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)