CAS 105107-84-4 appears in our catalog under these names: cis-4-Phenylthio-L-prolineHydrochloride, cis–4–Phenylthio–L–proline hydrochloride, Cis-4-phenylthio-l-proline hydrochloride, 97%, H-cis-4-PhenylThio-Pro-OH·HCl 95%, (4S)-4-(Phenylthio)-L-proline Hydrochloride, >95% (HPLC). Offered by: Biosynth, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 25mg, 100mg.
(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 105107-84-4) is a chemical compound with the molecular formula C11H14ClNO2S and a molecular weight of 259.75 g/mol. IUPAC name: (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: XXNAGGDFBCTLQA-IYPAPVHQSA-N.
| Molecular formula | C11H14ClNO2S |
|---|---|
| Molecular weight | 259.75 g/mol |
| IUPAC name | (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | XXNAGGDFBCTLQA-IYPAPVHQSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)SC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)